C29H23NO11S — CID 155523394
[12-(4-hydroxy-3-methoxyphenyl)-8,16,17-trimethoxy-3-oxo-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-7-yl] hydrogen sulfate (PubChem CID 155523394) has the molecular formula C29H23NO11S and a molecular weight of 593.57 g/mol. Its IUPAC name is [12-(4-hydroxy-3-methoxyphenyl)-8,16,17-trimethoxy-3-oxo-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-7-yl] hydrogen sulfate.
| Compound Name | [12-(4-hydroxy-3-methoxyphenyl)-8,16,17-trimethoxy-3-oxo-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-7-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 155523394 |
| Molecular Formula | C29H23NO11S |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | [12-(4-hydroxy-3-methoxyphenyl)-8,16,17-trimethoxy-3-oxo-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-7-yl] hydrogen sulfate |
| SMILES | COc1cc(-c2c3c4cc(OC)c(OS(=O)(=O)O)cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)ccc1O |
| InChI | InChI=1S/C29H23NO11S/c1-36-20-10-15(5-6-18(20)31)25-26-17-12-23(39-4)24(41-42(33,34)35)13-19(17)40-29(32)28(26)30-8-7-14-9-21(37-2)22(38-3)11-16(14)27(25)30/h5-13,31H,1-4H3,(H,33,34,35) |
| InChIKey | VFMRKCRAFSNPPO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 155.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|