C35H36N2O8 — CID 163570733
12-(3,4-dimethoxyphenyl)-7-[3-(dimethylamino)propoxy]-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 163570733) has the molecular formula C35H36N2O8 and a molecular weight of 612.68 g/mol. Its IUPAC name is 12-(3,4-dimethoxyphenyl)-7-[3-(dimethylamino)propoxy]-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 12-(3,4-dimethoxyphenyl)-7-[3-(dimethylamino)propoxy]-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 163570733 |
| Molecular Formula | C35H36N2O8 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 12-(3,4-dimethoxyphenyl)-7-[3-(dimethylamino)propoxy]-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1ccc(-c2c3c4cc(OC)c(OCCCN(C)C)cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)cc1OC |
| InChI | InChI=1S/C35H36N2O8/c1-36(2)12-8-14-44-30-19-25-23(18-29(30)43-7)32-31(21-9-10-24(39-3)26(16-21)40-4)33-22-17-28(42-6)27(41-5)15-20(22)11-13-37(33)34(32)35(38)45-25/h9-11,13,15-19H,8,12,14H2,1-7H3 |
| InChIKey | FZCLRTGNLYUHDO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 93.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|