C29H25N3O6 — CID 58685346
7-amino-12-(4-amino-3-methoxyphenyl)-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 58685346) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is 7-amino-12-(4-amino-3-methoxyphenyl)-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 7-amino-12-(4-amino-3-methoxyphenyl)-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 58685346 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 7-amino-12-(4-amino-3-methoxyphenyl)-8,16,17-trimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1cc(-c2c3c4cc(OC)c(N)cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)ccc1N |
| InChI | InChI=1S/C29H25N3O6/c1-34-21-10-15(5-6-18(21)30)25-26-17-12-22(35-2)19(31)13-20(17)38-29(33)28(26)32-8-7-14-9-23(36-3)24(37-4)11-16(14)27(25)32/h5-13H,30-31H2,1-4H3 |
| InChIKey | OZOBGBOBSNFSQK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|