C34H32ClNO8 — CID 132511663
12-(2-chloro-5-hydroxy-4-methoxyphenyl)-8,16-dimethoxy-7,17-di(propan-2-yloxy)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 132511663) has the molecular formula C34H32ClNO8 and a molecular weight of 618.08 g/mol. Its IUPAC name is 12-(2-chloro-5-hydroxy-4-methoxyphenyl)-8,16-dimethoxy-7,17-di(propan-2-yloxy)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 12-(2-chloro-5-hydroxy-4-methoxyphenyl)-8,16-dimethoxy-7,17-di(propan-2-yloxy)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 132511663 |
| Molecular Formula | C34H32ClNO8 |
| Molecular Weight | 618.08 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | 12-(2-chloro-5-hydroxy-4-methoxyphenyl)-8,16-dimethoxy-7,17-di(propan-2-yloxy)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1cc(Cl)c(-c2c3c4cc(OC)c(OC(C)C)cc4oc(=O)c3n3ccc4cc(OC(C)C)c(OC)cc4c23)cc1O |
| InChI | InChI=1S/C34H32ClNO8/c1-16(2)42-28-10-18-8-9-36-32(19(18)12-26(28)40-6)30(20-11-23(37)25(39-5)14-22(20)35)31-21-13-27(41-7)29(43-17(3)4)15-24(21)44-34(38)33(31)36/h8-17,37H,1-7H3 |
| InChIKey | WHBOGGSAVBHCHR-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.08 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|