C27H18N2O8 — CID 58685448
7-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8-methoxy-18-nitro-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14(19),15,17,20-nonaen-3-one (PubChem CID 58685448) has the molecular formula C27H18N2O8 and a molecular weight of 498.45 g/mol. Its IUPAC name is 7-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8-methoxy-18-nitro-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14(19),15,17,20-nonaen-3-one.
| Compound Name | 7-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8-methoxy-18-nitro-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14(19),15,17,20-nonaen-3-one |
|---|---|
| PubChem CID | 58685448 |
| Molecular Formula | C27H18N2O8 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 7-hydroxy-12-(4-hydroxy-3-methoxyphenyl)-8-methoxy-18-nitro-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14(19),15,17,20-nonaen-3-one |
| SMILES | COc1cc(-c2c3c4cc(OC)c(O)cc4oc(=O)c3n3ccc4c([N+](=O)[O-])cccc4c23)ccc1O |
| InChI | InChI=1S/C27H18N2O8/c1-35-21-10-13(6-7-18(21)30)23-24-16-11-22(36-2)19(31)12-20(16)37-27(32)26(24)28-9-8-14-15(25(23)28)4-3-5-17(14)29(33)34/h3-12,30-31H,1-2H3 |
| InChIKey | UUYYCQIWZFKEGA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|