C23H21NO8 — CID 101219196
1-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3-methyl-4-oxochromeno[3,4-b]pyrrole-2-carboxylic acid (PubChem CID 101219196) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3-methyl-4-oxochromeno[3,4-b]pyrrole-2-carboxylic acid.
| Compound Name | 1-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3-methyl-4-oxochromeno[3,4-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 101219196 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-7,8-dimethoxy-3-methyl-4-oxochromeno[3,4-b]pyrrole-2-carboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)n(C)c3c(=O)oc4cc(OC)c(OC)cc4c23)cc1OC |
| InChI | InChI=1S/C23H21NO8/c1-24-20(22(25)26)18(11-6-7-13(28-2)15(8-11)29-3)19-12-9-16(30-4)17(31-5)10-14(12)32-23(27)21(19)24/h6-10H,1-5H3,(H,25,26) |
| InChIKey | KMBHZNXQSFLJML-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|