C18H18O4 — CID 11033842
1,3,8-trimethoxy-6-methylanthracen-9-ol (PubChem CID 11033842) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1,3,8-trimethoxy-6-methylanthracen-9-ol.
| Compound Name | 1,3,8-trimethoxy-6-methylanthracen-9-ol |
|---|---|
| PubChem CID | 11033842 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1,3,8-trimethoxy-6-methylanthracen-9-ol |
| SMILES | COc1cc(OC)c2c(O)c3c(OC)cc(C)cc3cc2c1 |
| InChI | InChI=1S/C18H18O4/c1-10-5-11-7-12-8-13(20-2)9-15(22-4)17(12)18(19)16(11)14(6-10)21-3/h5-9,19H,1-4H3 |
| InChIKey | ALZTXUMPWBTBRJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|