C13H14O3 — CID 15404113
5,7-dimethoxy-3-methylnaphthalen-1-ol (PubChem CID 15404113) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 5,7-dimethoxy-3-methylnaphthalen-1-ol.
| Compound Name | 5,7-dimethoxy-3-methylnaphthalen-1-ol |
|---|---|
| PubChem CID | 15404113 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5,7-dimethoxy-3-methylnaphthalen-1-ol |
| SMILES | COc1cc(OC)c2cc(C)cc(O)c2c1 |
| InChI | InChI=1S/C13H14O3/c1-8-4-11-10(12(14)5-8)6-9(15-2)7-13(11)16-3/h4-7,14H,1-3H3 |
| InChIKey | KPGAPEADRITPBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |