C12H12O3 — CID 10608250
5-methoxy-7-methylnaphthalene-1,4-diol (PubChem CID 10608250) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-methoxy-7-methylnaphthalene-1,4-diol.
| Compound Name | 5-methoxy-7-methylnaphthalene-1,4-diol |
|---|---|
| PubChem CID | 10608250 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-methoxy-7-methylnaphthalene-1,4-diol |
| SMILES | COc1cc(C)cc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C12H12O3/c1-7-5-8-9(13)3-4-10(14)12(8)11(6-7)15-2/h3-6,13-14H,1-2H3 |
| InChIKey | OEXSGWRPFJDPNQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|