C19H18N2O2 — CID 136662732
4-[(3,5-dimethylphenyl)diazenyl]-8-methoxynaphthalen-1-ol (PubChem CID 136662732) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)diazenyl]-8-methoxynaphthalen-1-ol.
| Compound Name | 4-[(3,5-dimethylphenyl)diazenyl]-8-methoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 136662732 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)diazenyl]-8-methoxynaphthalen-1-ol |
| SMILES | COc1cccc2c(/N=N/c3cc(C)cc(C)c3)ccc(O)c12 |
| InChI | InChI=1S/C19H18N2O2/c1-12-9-13(2)11-14(10-12)20-21-16-7-8-17(22)19-15(16)5-4-6-18(19)23-3/h4-11,22H,1-3H3/b21-20+ |
| InChIKey | DOBGPDJSMBHFNI-QZQOTICOSA-N |
| XLogP | 5.59 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|