C17H15N3O — CID 136661697
8-[(3,5-dimethylphenyl)diazenyl]isoquinolin-5-ol (PubChem CID 136661697) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 8-[(3,5-dimethylphenyl)diazenyl]isoquinolin-5-ol.
| Compound Name | 8-[(3,5-dimethylphenyl)diazenyl]isoquinolin-5-ol |
|---|---|
| PubChem CID | 136661697 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 8-[(3,5-dimethylphenyl)diazenyl]isoquinolin-5-ol |
| SMILES | Cc1cc(C)cc(/N=N/c2ccc(O)c3ccncc23)c1 |
| InChI | InChI=1S/C17H15N3O/c1-11-7-12(2)9-13(8-11)19-20-16-3-4-17(21)14-5-6-18-10-15(14)16/h3-10,21H,1-2H3/b20-19+ |
| InChIKey | LNMXUUMQAGSCKC-FMQUCBEESA-N |
| XLogP | 4.97 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|