C30H24N2S — CID 118118636
1,3-bis(3,5-dimethylphenyl)thieno[3,4-f][2,9]phenanthroline (PubChem CID 118118636) has the molecular formula C30H24N2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 1,3-bis(3,5-dimethylphenyl)thieno[3,4-f][2,9]phenanthroline.
| Compound Name | 1,3-bis(3,5-dimethylphenyl)thieno[3,4-f][2,9]phenanthroline |
|---|---|
| PubChem CID | 118118636 |
| Molecular Formula | C30H24N2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1,3-bis(3,5-dimethylphenyl)thieno[3,4-f][2,9]phenanthroline |
| SMILES | Cc1cc(C)cc(-c2sc(-c3cc(C)cc(C)c3)c3c4ccncc4c4cnccc4c23)c1 |
| InChI | InChI=1S/C30H24N2S/c1-17-9-18(2)12-21(11-17)29-27-23-5-7-31-15-25(23)26-16-32-8-6-24(26)28(27)30(33-29)22-13-19(3)10-20(4)14-22/h5-16H,1-4H3 |
| InChIKey | RVTMBARHUVLPRD-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|