C20H18Br2S — CID 71445384
3,4-dibromo-2,5-bis(3,5-dimethylphenyl)thiophene (PubChem CID 71445384) has the molecular formula C20H18Br2S and a molecular weight of 450.24 g/mol. Its IUPAC name is 3,4-dibromo-2,5-bis(3,5-dimethylphenyl)thiophene.
| Compound Name | 3,4-dibromo-2,5-bis(3,5-dimethylphenyl)thiophene |
|---|---|
| PubChem CID | 71445384 |
| Molecular Formula | C20H18Br2S |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | 3,4-dibromo-2,5-bis(3,5-dimethylphenyl)thiophene |
| SMILES | Cc1cc(C)cc(-c2sc(-c3cc(C)cc(C)c3)c(Br)c2Br)c1 |
| InChI | InChI=1S/C20H18Br2S/c1-11-5-12(2)8-15(7-11)19-17(21)18(22)20(23-19)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | OYBDISLPSBMCOI-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |