C12H18CrO3 — CID 15823960
chromium;formaldehyde;1,3,5-trimethylbenzene (PubChem CID 15823960) has the molecular formula C12H18CrO3 and a molecular weight of 262.27 g/mol. Its IUPAC name is chromium;formaldehyde;1,3,5-trimethylbenzene.
| Compound Name | chromium;formaldehyde;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 15823960 |
| Molecular Formula | C12H18CrO3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | chromium;formaldehyde;1,3,5-trimethylbenzene |
| SMILES | C=O.C=O.C=O.Cc1cc(C)cc(C)c1.[Cr] |
| InChI | InChI=1S/C9H12.3CH2O.Cr/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;3*1H2; |
| InChIKey | FKKJUQOQQXSXSA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |