C12H11N3O2 — CID 177490373
2-methyl-4-(pyridin-3-yldiazenyl)benzene-1,3-diol (PubChem CID 177490373) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-methyl-4-(pyridin-3-yldiazenyl)benzene-1,3-diol.
| Compound Name | 2-methyl-4-(pyridin-3-yldiazenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 177490373 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methyl-4-(pyridin-3-yldiazenyl)benzene-1,3-diol |
| SMILES | Cc1c(O)ccc(/N=N/c2cccnc2)c1O |
| InChI | InChI=1S/C12H11N3O2/c1-8-11(16)5-4-10(12(8)17)15-14-9-3-2-6-13-7-9/h2-7,16-17H,1H3/b15-14+ |
| InChIKey | VDVFFCGIBJKTRZ-CCEZHUSRSA-N |
| XLogP | 3.22 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|