About butanedioic acid;dipyridin-3-yldiazene
butanedioic acid;dipyridin-3-yldiazene (PubChem CID 139196676) has the molecular formula C14H14N4O4
and a molecular weight of 302.29 g/mol. Its IUPAC name is butanedioic acid;dipyridin-3-yldiazene.
Molecular Properties
| Compound Name | butanedioic acid;dipyridin-3-yldiazene |
| PubChem CID | 139196676 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | butanedioic acid;dipyridin-3-yldiazene |
| SMILES | O=C(O)CCC(=O)O.c1cncc(/N=N/c2cccnc2)c1 |
| InChI | InChI=1S/C10H8N4.C4H6O4/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10;5-3(6)1-2-4(7)8/h1-8H;1-2H2,(H,5,6)(H,7,8)/b14-13+; |
| InChIKey | GFLITRVUBDLVNX-IERUDJENSA-N |
| XLogP | 2.83 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;dipyridin-3-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;dipyridin-3-yldiazene?
The IUPAC name of butanedioic acid;dipyridin-3-yldiazene (CID 139196676) is butanedioic acid;dipyridin-3-yldiazene.
What is the SMILES notation for butanedioic acid;dipyridin-3-yldiazene?
The canonical SMILES for butanedioic acid;dipyridin-3-yldiazene is O=C(O)CCC(=O)O.c1cncc(/N=N/c2cccnc2)c1.
What is the InChIKey of butanedioic acid;dipyridin-3-yldiazene?
The InChIKey is GFLITRVUBDLVNX-IERUDJENSA-N. The full InChI is InChI=1S/C10H8N4.C4H6O4/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10;5-3(6)1-2-4(7)8/h1-8H;1-2H2,(H,5,6)(H,7,8)/b14-13+;.
What are the key properties of butanedioic acid;dipyridin-3-yldiazene?
butanedioic acid;dipyridin-3-yldiazene has a molecular weight of 302.29 g/mol, XLogP of 2.83, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;dipyridin-3-yldiazene is sourced from PubChem (CID 139196676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).