C15H16N2O — CID 3520182
2-[(3,5-dimethylphenyl)diazenyl]-4-methylphenol (PubChem CID 3520182) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)diazenyl]-4-methylphenol.
| Compound Name | 2-[(3,5-dimethylphenyl)diazenyl]-4-methylphenol |
|---|---|
| PubChem CID | 3520182 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)diazenyl]-4-methylphenol |
| SMILES | Cc1cc(C)cc(/N=N/c2cc(C)ccc2O)c1 |
| InChI | InChI=1S/C15H16N2O/c1-10-4-5-15(18)14(9-10)17-16-13-7-11(2)6-12(3)8-13/h4-9,18H,1-3H3/b17-16+ |
| InChIKey | KPZFZSXCDYBPAQ-WUKNDPDISA-N |
| XLogP | 4.73 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|