C14H14O6 — CID 621352
3-hydroxy-1,6,8-trimethoxynaphthalene-2-carboxylic acid (PubChem CID 621352) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-hydroxy-1,6,8-trimethoxynaphthalene-2-carboxylic acid.
| Compound Name | 3-hydroxy-1,6,8-trimethoxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 621352 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-hydroxy-1,6,8-trimethoxynaphthalene-2-carboxylic acid |
| SMILES | COc1cc(OC)c2c(OC)c(C(=O)O)c(O)cc2c1 |
| InChI | InChI=1S/C14H14O6/c1-18-8-4-7-5-9(15)12(14(16)17)13(20-3)11(7)10(6-8)19-2/h4-6,15H,1-3H3,(H,16,17) |
| InChIKey | JFGZVHQYVXSZPV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |