C16H18O3 — CID 872909
1-(1,8-dimethoxy-3,6-dimethylnaphthalen-2-yl)ethanone (PubChem CID 872909) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-(1,8-dimethoxy-3,6-dimethylnaphthalen-2-yl)ethanone.
| Compound Name | 1-(1,8-dimethoxy-3,6-dimethylnaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 872909 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-(1,8-dimethoxy-3,6-dimethylnaphthalen-2-yl)ethanone |
| SMILES | COc1cc(C)cc2cc(C)c(C(C)=O)c(OC)c12 |
| InChI | InChI=1S/C16H18O3/c1-9-6-12-8-10(2)14(11(3)17)16(19-5)15(12)13(7-9)18-4/h6-8H,1-5H3 |
| InChIKey | HFLLUOHLNRRCQM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |