C13H15NO2 — CID 82493293
1-(7-methoxy-2,5-dimethyl-1H-indol-3-yl)ethanone (PubChem CID 82493293) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(7-methoxy-2,5-dimethyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-(7-methoxy-2,5-dimethyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 82493293 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(7-methoxy-2,5-dimethyl-1H-indol-3-yl)ethanone |
| SMILES | COc1cc(C)cc2c(C(C)=O)c(C)[nH]c12 |
| InChI | InChI=1S/C13H15NO2/c1-7-5-10-12(9(3)15)8(2)14-13(10)11(6-7)16-4/h5-6,14H,1-4H3 |
| InChIKey | LASPYZORCVBFBZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |