C19H16O7 — CID 11394165
1,6,8-trimethoxy-3-methyl-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 11394165) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 1,6,8-trimethoxy-3-methyl-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 1,6,8-trimethoxy-3-methyl-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 11394165 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1,6,8-trimethoxy-3-methyl-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(C)c(C(=O)O)c(OC)c1C2=O |
| InChI | InChI=1S/C19H16O7/c1-8-5-10-15(18(26-4)13(8)19(22)23)17(21)14-11(16(10)20)6-9(24-2)7-12(14)25-3/h5-7H,1-4H3,(H,22,23) |
| InChIKey | ODQSZBNLUJJKIK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|