C43H37NO8 — CID 10532704
benzhydryl (2R)-2-[(1,9,11-trimethoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoate (PubChem CID 10532704) has the molecular formula C43H37NO8 and a molecular weight of 695.77 g/mol. Its IUPAC name is benzhydryl (2R)-2-[(1,9,11-trimethoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoate.
| Compound Name | benzhydryl (2R)-2-[(1,9,11-trimethoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 10532704 |
| Molecular Formula | C43H37NO8 |
| Molecular Weight | 695.77 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | benzhydryl (2R)-2-[(1,9,11-trimethoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl)amino]propanoate |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc3c(cc1C2=O)CCc1cc(C)c(C(=O)N[C@H](C)C(=O)OC(c2ccccc2)c2ccccc2)c(OC)c1-3 |
| InChI | InChI=1S/C43H37NO8/c1-23-18-28-17-16-27-19-31-32(38(45)33-20-29(49-3)21-34(50-4)37(33)39(31)46)22-30(27)36(28)41(51-5)35(23)42(47)44-24(2)43(48)52-40(25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-15,18-22,24,40H,16-17H2,1-5H3,(H,44,47)/t24-/m1/s1 |
| InChIKey | ASIYMBKLAHQQFE-XMMPIXPASA-N |
| XLogP | 7.01 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.77 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|