About 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione
8-hydroxy-1,3-dimethoxyanthracene-9,10-dione (PubChem CID 158328422) has the molecular formula C32H24O10
and a molecular weight of 568.53 g/mol. Its IUPAC name is 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione |
| PubChem CID | 158328422 |
| Molecular Formula | C32H24O10 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O.COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/2C16H12O5/c2*1-20-8-6-10-14(12(7-8)21-2)16(19)13-9(15(10)18)4-3-5-11(13)17/h2*3-7,17H,1-2H3 |
| InChIKey | GPRWNDQOQCUMNE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione?
The IUPAC name of 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione (CID 158328422) is 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione.
What is the SMILES notation for 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione?
The canonical SMILES for 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione is COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O.COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione?
The InChIKey is GPRWNDQOQCUMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H12O5/c2*1-20-8-6-10-14(12(7-8)21-2)16(19)13-9(15(10)18)4-3-5-11(13)17/h2*3-7,17H,1-2H3.
What are the key properties of 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione?
8-hydroxy-1,3-dimethoxyanthracene-9,10-dione has a molecular weight of 568.53 g/mol, XLogP of 4.37, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione is sourced from PubChem (CID 158328422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).