C32H24O10 — CID 158328422
8-hydroxy-1,3-dimethoxyanthracene-9,10-dione (PubChem CID 158328422) has the molecular formula C32H24O10 and a molecular weight of 568.53 g/mol. Its IUPAC name is 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione.
| Compound Name | 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 158328422 |
| Molecular Formula | C32H24O10 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 8-hydroxy-1,3-dimethoxyanthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O.COc1cc(OC)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/2C16H12O5/c2*1-20-8-6-10-14(12(7-8)21-2)16(19)13-9(15(10)18)4-3-5-11(13)17/h2*3-7,17H,1-2H3 |
| InChIKey | GPRWNDQOQCUMNE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|