C20H21NO5 — CID 14563125
3-(ethylaminomethyl)-1,6,8-trimethoxyanthracene-9,10-dione (PubChem CID 14563125) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-1,6,8-trimethoxyanthracene-9,10-dione.
| Compound Name | 3-(ethylaminomethyl)-1,6,8-trimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 14563125 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-(ethylaminomethyl)-1,6,8-trimethoxyanthracene-9,10-dione |
| SMILES | CCNCc1cc(OC)c2c(c1)C(=O)c1cc(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C20H21NO5/c1-5-21-10-11-6-13-17(15(7-11)25-3)20(23)18-14(19(13)22)8-12(24-2)9-16(18)26-4/h6-9,21H,5,10H2,1-4H3 |
| InChIKey | IXGSHNBDYPXOAG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|