C28H38NO5+ — CID 70689102
dimethyl-octyl-[(4,5,7-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]azanium (PubChem CID 70689102) has the molecular formula C28H38NO5+ and a molecular weight of 468.61 g/mol. Its IUPAC name is dimethyl-octyl-[(4,5,7-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]azanium.
| Compound Name | dimethyl-octyl-[(4,5,7-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 70689102 |
| Molecular Formula | C28H38NO5+ |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | dimethyl-octyl-[(4,5,7-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]azanium |
| SMILES | CCCCCCCC[N+](C)(C)Cc1cc(OC)c2c(c1)C(=O)c1cc(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C28H38NO5/c1-7-8-9-10-11-12-13-29(2,3)18-19-14-21-25(23(15-19)33-5)28(31)26-22(27(21)30)16-20(32-4)17-24(26)34-6/h14-17H,7-13,18H2,1-6H3/q+1 |
| InChIKey | YJRMIQLQNKXDPS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|