C29H40NO5+ — CID 71504093
decyl-[(5-hydroxy-4,7-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]-dimethylazanium (PubChem CID 71504093) has the molecular formula C29H40NO5+ and a molecular weight of 482.64 g/mol. Its IUPAC name is decyl-[(5-hydroxy-4,7-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]-dimethylazanium.
| Compound Name | decyl-[(5-hydroxy-4,7-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 71504093 |
| Molecular Formula | C29H40NO5+ |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | decyl-[(5-hydroxy-4,7-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]-dimethylazanium |
| SMILES | CCCCCCCCCC[N+](C)(C)Cc1cc(OC)c2c(c1)C(=O)c1cc(OC)cc(O)c1C2=O |
| InChI | InChI=1S/C29H39NO5/c1-6-7-8-9-10-11-12-13-14-30(2,3)19-20-15-22-27(25(16-20)35-5)29(33)26-23(28(22)32)17-21(34-4)18-24(26)31/h15-18H,6-14,19H2,1-5H3/p+1 |
| InChIKey | UCUJVWOPYFEABH-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|