C35H52NO5+ — CID 71506468
2-(8-hydroxy-6-methoxy-3-methyl-9,10-dioxoanthracen-1-yl)oxyethyl-methyl-dioctylazanium (PubChem CID 71506468) has the molecular formula C35H52NO5+ and a molecular weight of 566.80 g/mol. Its IUPAC name is 2-(8-hydroxy-6-methoxy-3-methyl-9,10-dioxoanthracen-1-yl)oxyethyl-methyl-dioctylazanium.
| Compound Name | 2-(8-hydroxy-6-methoxy-3-methyl-9,10-dioxoanthracen-1-yl)oxyethyl-methyl-dioctylazanium |
|---|---|
| PubChem CID | 71506468 |
| Molecular Formula | C35H52NO5+ |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 2-(8-hydroxy-6-methoxy-3-methyl-9,10-dioxoanthracen-1-yl)oxyethyl-methyl-dioctylazanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCOc1cc(C)cc2c1C(=O)c1c(O)cc(OC)cc1C2=O |
| InChI | InChI=1S/C35H51NO5/c1-6-8-10-12-14-16-18-36(4,19-17-15-13-11-9-7-2)20-21-41-31-23-26(3)22-28-33(31)35(39)32-29(34(28)38)24-27(40-5)25-30(32)37/h22-25H,6-21H2,1-5H3/p+1 |
| InChIKey | VRGMOAMKXAOMBZ-UHFFFAOYSA-O |
| XLogP | 8.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|