C19H14O7 — CID 11046434
11-hydroxy-7,9-dimethoxy-3-methyl-3H-naphtho[3,2-f][2]benzofuran-1,5,10-trione (PubChem CID 11046434) has the molecular formula C19H14O7 and a molecular weight of 354.31 g/mol. Its IUPAC name is 11-hydroxy-7,9-dimethoxy-3-methyl-3H-naphtho[3,2-f][2]benzofuran-1,5,10-trione.
| Compound Name | 11-hydroxy-7,9-dimethoxy-3-methyl-3H-naphtho[3,2-f][2]benzofuran-1,5,10-trione |
|---|---|
| PubChem CID | 11046434 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 11-hydroxy-7,9-dimethoxy-3-methyl-3H-naphtho[3,2-f][2]benzofuran-1,5,10-trione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc3c(c(O)c1C2=O)C(=O)OC3C |
| InChI | InChI=1S/C19H14O7/c1-7-9-6-11-14(18(22)15(9)19(23)26-7)17(21)13-10(16(11)20)4-8(24-2)5-12(13)25-3/h4-7,22H,1-3H3 |
| InChIKey | RIIKBAQXZPVQQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|