C26H27FN2O6 — CID 134294450
[(1S,2S)-1-(4-fluoro-2-methylphenyl)-1-phenylpropan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 134294450) has the molecular formula C26H27FN2O6 and a molecular weight of 482.51 g/mol. Its IUPAC name is [(1S,2S)-1-(4-fluoro-2-methylphenyl)-1-phenylpropan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(1S,2S)-1-(4-fluoro-2-methylphenyl)-1-phenylpropan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 134294450 |
| Molecular Formula | C26H27FN2O6 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(1S,2S)-1-(4-fluoro-2-methylphenyl)-1-phenylpropan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | COc1cc[n+]([O-])c(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccccc2)c2ccc(F)cc2C)c1O |
| InChI | InChI=1S/C26H27FN2O6/c1-15-14-19(27)10-11-20(15)22(18-8-6-5-7-9-18)17(3)35-26(32)16(2)28-25(31)23-24(30)21(34-4)12-13-29(23)33/h5-14,16-17,22,30H,1-4H3,(H,28,31)/t16-,17-,22?/m0/s1 |
| InChIKey | BIDFRPPDXGGWTE-ASCMOBCVSA-N |
| XLogP | 3.36 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|