C23H30N2O7 — CID 134294435
[(3S,4R)-5-methyl-4-phenoxyhexan-3-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 134294435) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(3S,4R)-5-methyl-4-phenoxyhexan-3-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(3S,4R)-5-methyl-4-phenoxyhexan-3-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 134294435 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | [(3S,4R)-5-methyl-4-phenoxyhexan-3-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | CC[C@H](OC(=O)[C@H](C)NC(=O)c1c(O)c(OC)cc[n+]1[O-])[C@H](Oc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H30N2O7/c1-6-17(21(14(2)3)31-16-10-8-7-9-11-16)32-23(28)15(4)24-22(27)19-20(26)18(30-5)12-13-25(19)29/h7-15,17,21,26H,6H2,1-5H3,(H,24,27)/t15-,17-,21+/m0/s1 |
| InChIKey | RCTPQOAZJSOHPF-HZUJVAHNSA-N |
| XLogP | 2.58 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|