C25H34N2O6 — CID 135186101
[(2S,3R)-3-(2,4-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-[(4-ethoxy-3-hydroxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 135186101) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is [(2S,3R)-3-(2,4-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-[(4-ethoxy-3-hydroxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(2S,3R)-3-(2,4-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-[(4-ethoxy-3-hydroxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 135186101 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | [(2S,3R)-3-(2,4-dimethylphenyl)-4-methylpentan-2-yl] (2S)-2-[(4-ethoxy-3-hydroxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | CCOc1cc[n+]([O-])c(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccc(C)cc2C)C(C)C)c1O |
| InChI | InChI=1S/C25H34N2O6/c1-8-32-20-11-12-27(31)22(23(20)28)24(29)26-17(6)25(30)33-18(7)21(14(2)3)19-10-9-15(4)13-16(19)5/h9-14,17-18,21,28H,8H2,1-7H3,(H,26,29)/t17-,18-,21?/m0/s1 |
| InChIKey | XHCDGPLMEDBBIL-GAOSQQNJSA-N |
| XLogP | 3.53 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|