C30H33F2NO8 — CID 158508229
[(2S)-1,1-bis(2-ethoxy-4-fluorophenyl)propan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-yl)-2-methyl-4-oxobutanoate (PubChem CID 158508229) has the molecular formula C30H33F2NO8 and a molecular weight of 573.59 g/mol. Its IUPAC name is [(2S)-1,1-bis(2-ethoxy-4-fluorophenyl)propan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-yl)-2-methyl-4-oxobutanoate.
| Compound Name | [(2S)-1,1-bis(2-ethoxy-4-fluorophenyl)propan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-yl)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 158508229 |
| Molecular Formula | C30H33F2NO8 |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | [(2S)-1,1-bis(2-ethoxy-4-fluorophenyl)propan-2-yl] (2R)-4-(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-yl)-2-methyl-4-oxobutanoate |
| SMILES | CCOc1cc(F)ccc1C(c1ccc(F)cc1OCC)[C@H](C)OC(=O)[C@H](C)CC(=O)c1c(O)c(OC)cc[n+]1[O-] |
| InChI | InChI=1S/C30H33F2NO8/c1-6-39-25-15-19(31)8-10-21(25)27(22-11-9-20(32)16-26(22)40-7-2)18(4)41-30(36)17(3)14-23(34)28-29(35)24(38-5)12-13-33(28)37/h8-13,15-18,27,35H,6-7,14H2,1-5H3/t17-,18+/m1/s1 |
| InChIKey | HKSMNWFVPQUJFI-MSOLQXFVSA-N |
| XLogP | 5.08 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|