C25H24Cl2N2O6 — CID 134294462
[(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 134294462) has the molecular formula C25H24Cl2N2O6 and a molecular weight of 519.38 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 134294462 |
| Molecular Formula | C25H24Cl2N2O6 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-hydroxy-4-methoxy-1-oxidopyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | COc1cc[n+]([O-])c(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C25H24Cl2N2O6/c1-14(28-24(31)22-23(30)20(34-3)12-13-29(22)33)25(32)35-15(2)21(16-4-8-18(26)9-5-16)17-6-10-19(27)11-7-17/h4-15,21,30H,1-3H3,(H,28,31)/t14-,15-/m0/s1 |
| InChIKey | HCZJNDQPDZZBFO-GJZGRUSLSA-N |
| XLogP | 4.22 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|