C28H28Cl2N2O7 — CID 121463562
[(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate (PubChem CID 121463562) has the molecular formula C28H28Cl2N2O7 and a molecular weight of 575.45 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate.
| Compound Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 121463562 |
| Molecular Formula | C28H28Cl2N2O7 |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
| SMILES | COc1ccnc(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1OCOC(C)=O |
| InChI | InChI=1S/C28H28Cl2N2O7/c1-16(32-27(34)25-26(38-15-37-18(3)33)23(36-4)13-14-31-25)28(35)39-17(2)24(19-5-9-21(29)10-6-19)20-7-11-22(30)12-8-20/h5-14,16-17,24H,15H2,1-4H3,(H,32,34)/t16-,17-/m0/s1 |
| InChIKey | VCUNPEFDXHXPJS-IRXDYDNUSA-N |
| XLogP | 5.18 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|