C23H34N2O9 — CID 121466135
[(2S,3R)-2-[(2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoyl]oxy-4-methylpentan-3-yl] 2-methylpropanoate (PubChem CID 121466135) has the molecular formula C23H34N2O9 and a molecular weight of 482.53 g/mol. Its IUPAC name is [(2S,3R)-2-[(2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoyl]oxy-4-methylpentan-3-yl] 2-methylpropanoate.
| Compound Name | [(2S,3R)-2-[(2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoyl]oxy-4-methylpentan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 121466135 |
| Molecular Formula | C23H34N2O9 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(2S,3R)-2-[(2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoyl]oxy-4-methylpentan-3-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@@H](C)C(=O)O[C@@H](C)[C@H](OC(=O)C(C)C)C(C)C)c1OCOC(C)=O |
| InChI | InChI=1S/C23H34N2O9/c1-12(2)19(34-22(28)13(3)4)15(6)33-23(29)14(5)25-21(27)18-20(32-11-31-16(7)26)17(30-8)9-10-24-18/h9-10,12-15,19H,11H2,1-8H3,(H,25,27)/t14-,15-,19+/m0/s1 |
| InChIKey | VXBCWQCXRYCKDS-YZVOILCLSA-N |
| XLogP | 2.26 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|