C28H24F6N2O7 — CID 121463920
[(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate (PubChem CID 121463920) has the molecular formula C28H24F6N2O7 and a molecular weight of 614.50 g/mol. Its IUPAC name is [(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate.
| Compound Name | [(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 121463920 |
| Molecular Formula | C28H24F6N2O7 |
| Molecular Weight | 614.50 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | [(2S)-1,1-bis(3,4,5-trifluorophenyl)propan-2-yl] (2S)-2-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]propanoate |
| SMILES | COc1ccnc(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2cc(F)c(F)c(F)c2)c2cc(F)c(F)c(F)c2)c1OCOC(C)=O |
| InChI | InChI=1S/C28H24F6N2O7/c1-12(36-27(38)25-26(42-11-41-14(3)37)21(40-4)5-6-35-25)28(39)43-13(2)22(15-7-17(29)23(33)18(30)8-15)16-9-19(31)24(34)20(32)10-16/h5-10,12-13,22H,11H2,1-4H3,(H,36,38)/t12-,13-/m0/s1 |
| InChIKey | HYLUWYJQKBXQMK-STQMWFEESA-N |
| XLogP | 4.71 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|