C27H26Cl2N2O5S — CID 134294284
[(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbothioyl)amino]propanoate (PubChem CID 134294284) has the molecular formula C27H26Cl2N2O5S and a molecular weight of 561.49 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbothioyl)amino]propanoate.
| Compound Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbothioyl)amino]propanoate |
|---|---|
| PubChem CID | 134294284 |
| Molecular Formula | C27H26Cl2N2O5S |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | [(2S)-1,1-bis(4-chlorophenyl)propan-2-yl] (2S)-2-[(3-acetyloxy-4-methoxypyridine-2-carbothioyl)amino]propanoate |
| SMILES | COc1ccnc(C(=S)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1OC(C)=O |
| InChI | InChI=1S/C27H26Cl2N2O5S/c1-15(31-26(37)24-25(36-17(3)32)22(34-4)13-14-30-24)27(33)35-16(2)23(18-5-9-20(28)10-6-18)19-7-11-21(29)12-8-19/h5-16,23H,1-4H3,(H,31,37)/t15-,16-/m0/s1 |
| InChIKey | ORUXMRPKNRWFPQ-HOTGVXAUSA-N |
| XLogP | 5.74 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|