C29H35N2O8+ — CID 170226744
[(2S)-1,1-bis(3-methoxy-4-methylphenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 170226744) has the molecular formula C29H35N2O8+ and a molecular weight of 539.61 g/mol. Its IUPAC name is [(2S)-1,1-bis(3-methoxy-4-methylphenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(2S)-1,1-bis(3-methoxy-4-methylphenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 170226744 |
| Molecular Formula | C29H35N2O8+ |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | [(2S)-1,1-bis(3-methoxy-4-methylphenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | COc1cc(C(c2ccc(C)c(OC)c2)[C@H](C)OC(=O)[C@H](C)NC(=O)c2c(O)c(OC)cc[n+]2O)ccc1C |
| InChI | InChI=1S/C29H34N2O8/c1-16-8-10-20(14-23(16)37-6)25(21-11-9-17(2)24(15-21)38-7)19(4)39-29(34)18(3)30-28(33)26-27(32)22(36-5)12-13-31(26)35/h8-15,18-19,25H,1-7H3,(H2-,30,32,33,35)/p+1/t18-,19-/m0/s1 |
| InChIKey | RKRHUCZTVXOFPG-OALUTQOASA-O |
| XLogP | 3.44 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|