C25H23Cl2F2N2O6+ — CID 170226668
[(2S)-1,1-bis(4-chloro-3-fluorophenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate (PubChem CID 170226668) has the molecular formula C25H23Cl2F2N2O6+ and a molecular weight of 556.37 g/mol. Its IUPAC name is [(2S)-1,1-bis(4-chloro-3-fluorophenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate.
| Compound Name | [(2S)-1,1-bis(4-chloro-3-fluorophenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 170226668 |
| Molecular Formula | C25H23Cl2F2N2O6+ |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | [(2S)-1,1-bis(4-chloro-3-fluorophenyl)propan-2-yl] (2S)-2-[(1,3-dihydroxy-4-methoxypyridin-1-ium-2-carbonyl)amino]propanoate |
| SMILES | COc1cc[n+](O)c(C(=O)N[C@@H](C)C(=O)O[C@@H](C)C(c2ccc(Cl)c(F)c2)c2ccc(Cl)c(F)c2)c1O |
| InChI | InChI=1S/C25H22Cl2F2N2O6/c1-12(30-24(33)22-23(32)20(36-3)8-9-31(22)35)25(34)37-13(2)21(14-4-6-16(26)18(28)10-14)15-5-7-17(27)19(29)11-15/h4-13,21H,1-3H3,(H2-,30,32,33,35)/p+1/t12-,13-/m0/s1 |
| InChIKey | GQQQSNZUYZHUPL-STQMWFEESA-O |
| XLogP | 4.39 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|