C15H18O4 — CID 10445415
3-[(2R)-2-hydroxypropyl]-6,8-dimethoxynaphthalen-1-ol (PubChem CID 10445415) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxypropyl]-6,8-dimethoxynaphthalen-1-ol.
| Compound Name | 3-[(2R)-2-hydroxypropyl]-6,8-dimethoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 10445415 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-[(2R)-2-hydroxypropyl]-6,8-dimethoxynaphthalen-1-ol |
| SMILES | COc1cc(OC)c2c(O)cc(C[C@@H](C)O)cc2c1 |
| InChI | InChI=1S/C15H18O4/c1-9(16)4-10-5-11-7-12(18-2)8-14(19-3)15(11)13(17)6-10/h5-9,16-17H,4H2,1-3H3/t9-/m1/s1 |
| InChIKey | JSEUZEQTUXBQCS-SECBINFHSA-N |
| XLogP | 2.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |