C16H20O4 — CID 70555002
1-(1,3,6-trimethoxynaphthalen-2-yl)propan-2-ol (PubChem CID 70555002) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(1,3,6-trimethoxynaphthalen-2-yl)propan-2-ol.
| Compound Name | 1-(1,3,6-trimethoxynaphthalen-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 70555002 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(1,3,6-trimethoxynaphthalen-2-yl)propan-2-ol |
| SMILES | COc1ccc2c(OC)c(CC(C)O)c(OC)cc2c1 |
| InChI | InChI=1S/C16H20O4/c1-10(17)7-14-15(19-3)9-11-8-12(18-2)5-6-13(11)16(14)20-4/h5-6,8-10,17H,7H2,1-4H3 |
| InChIKey | UNCUNKGWJVKIQG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |