C8H8O5 — CID 15647609
3,6-dihydroxy-2-methoxybenzoic acid (PubChem CID 15647609) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 3,6-dihydroxy-2-methoxybenzoic acid.
| Compound Name | 3,6-dihydroxy-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 15647609 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 3,6-dihydroxy-2-methoxybenzoic acid |
| SMILES | COc1c(O)ccc(O)c1C(=O)O |
| InChI | InChI=1S/C8H8O5/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | LEYBYZMFOFATIO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|