About 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one
3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one (PubChem CID 2755139) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one.
Analyze 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one (CID 2755139) is 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one is COc1c(O)ccccc1=O.
What is the InChIKey of 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one?
The InChIKey is BIDFQZFXUARDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-11-8-6(9)4-2-3-5-7(8)10/h2-5,9H,1H3.
What are the key properties of 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one?
3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one has a molecular weight of 152.15 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methoxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 2755139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).