C9H10O3 — CID 101076460
6-ethoxy-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 101076460) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 6-ethoxy-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 6-ethoxy-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 101076460 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 6-ethoxy-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | CCOc1cccc(O)c(=O)c1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-7-4-3-5-8(10)9(11)6-7/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | BCGKGZYINUZSIF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |