C24H27NO3 — CID 70603517
3-ethoxy-N,N-bis(3-ethoxyphenyl)aniline (PubChem CID 70603517) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-ethoxy-N,N-bis(3-ethoxyphenyl)aniline.
| Compound Name | 3-ethoxy-N,N-bis(3-ethoxyphenyl)aniline |
|---|---|
| PubChem CID | 70603517 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-ethoxy-N,N-bis(3-ethoxyphenyl)aniline |
| SMILES | CCOc1cccc(N(c2cccc(OCC)c2)c2cccc(OCC)c2)c1 |
| InChI | InChI=1S/C24H27NO3/c1-4-26-22-13-7-10-19(16-22)25(20-11-8-14-23(17-20)27-5-2)21-12-9-15-24(18-21)28-6-3/h7-18H,4-6H2,1-3H3 |
| InChIKey | JUIHJGIUWQEPRH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |