About 3-ethoxyphenol;iodoethane
3-ethoxyphenol;iodoethane (PubChem CID 162028202) has the molecular formula C10H15IO2
and a molecular weight of 294.13 g/mol. Its IUPAC name is 3-ethoxyphenol;iodoethane.
Molecular Properties
| Compound Name | 3-ethoxyphenol;iodoethane |
| PubChem CID | 162028202 |
| Molecular Formula | C10H15IO2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-ethoxyphenol;iodoethane |
| SMILES | CCI.CCOc1cccc(O)c1 |
| InChI | InChI=1S/C8H10O2.C2H5I/c1-2-10-8-5-3-4-7(9)6-8;1-2-3/h3-6,9H,2H2,1H3;2H2,1H3 |
| InChIKey | YVQYUFIDACYLKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxyphenol;iodoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxyphenol;iodoethane?
The IUPAC name of 3-ethoxyphenol;iodoethane (CID 162028202) is 3-ethoxyphenol;iodoethane.
What is the SMILES notation for 3-ethoxyphenol;iodoethane?
The canonical SMILES for 3-ethoxyphenol;iodoethane is CCI.CCOc1cccc(O)c1.
What is the InChIKey of 3-ethoxyphenol;iodoethane?
The InChIKey is YVQYUFIDACYLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C2H5I/c1-2-10-8-5-3-4-7(9)6-8;1-2-3/h3-6,9H,2H2,1H3;2H2,1H3.
What are the key properties of 3-ethoxyphenol;iodoethane?
3-ethoxyphenol;iodoethane has a molecular weight of 294.13 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxyphenol;iodoethane is sourced from PubChem (CID 162028202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).