About 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione
11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione (PubChem CID 10066319) has the molecular formula C21H16O5
and a molecular weight of 348.35 g/mol. Its IUPAC name is 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione.
Molecular Properties
| Compound Name | 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione |
| PubChem CID | 10066319 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(cc3cc(C)cc(OC)c3c1O)C2=O |
| InChI | InChI=1S/C21H16O5/c1-10-7-11-9-13-18(20(23)16(11)15(8-10)26-3)21(24)17-12(19(13)22)5-4-6-14(17)25-2/h4-9,23H,1-3H3 |
| InChIKey | XLDXVNRWUFCXFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione?
The IUPAC name of 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione (CID 10066319) is 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione.
What is the SMILES notation for 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione?
The canonical SMILES for 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione is COc1cccc2c1C(=O)c1c(cc3cc(C)cc(OC)c3c1O)C2=O.
What is the InChIKey of 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione?
The InChIKey is XLDXVNRWUFCXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O5/c1-10-7-11-9-13-18(20(23)16(11)15(8-10)26-3)21(24)17-12(19(13)22)5-4-6-14(17)25-2/h4-9,23H,1-3H3.
What are the key properties of 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione?
11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione has a molecular weight of 348.35 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione is sourced from PubChem (CID 10066319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).