C21H16O5 — CID 10066319
11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione (PubChem CID 10066319) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione.
| Compound Name | 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione |
|---|---|
| PubChem CID | 10066319 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 11-hydroxy-1,10-dimethoxy-8-methyltetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(cc3cc(C)cc(OC)c3c1O)C2=O |
| InChI | InChI=1S/C21H16O5/c1-10-7-11-9-13-18(20(23)16(11)15(8-10)26-3)21(24)17-12(19(13)22)5-4-6-14(17)25-2/h4-9,23H,1-3H3 |
| InChIKey | XLDXVNRWUFCXFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|