C22H22O6 — CID 95931143
1-hydroxy-8-methoxy-3-methyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]anthracene-9,10-dione (PubChem CID 95931143) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-hydroxy-8-methoxy-3-methyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]anthracene-9,10-dione.
| Compound Name | 1-hydroxy-8-methoxy-3-methyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 95931143 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-hydroxy-8-methoxy-3-methyl-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]anthracene-9,10-dione |
| SMILES | COc1cccc2c1C(=O)c1c(cc(C)c(CCC3(C)OCCO3)c1O)C2=O |
| InChI | InChI=1S/C22H22O6/c1-12-11-15-18(20(24)13(12)7-8-22(2)27-9-10-28-22)21(25)17-14(19(15)23)5-4-6-16(17)26-3/h4-6,11,24H,7-10H2,1-3H3 |
| InChIKey | VZVHOBHITLBHNB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|