C20H16O6 — CID 11057281
7-methoxy-2,2,5-trimethylnaphtho[3,2-g][1,3]benzodioxine-4,6,11-trione (PubChem CID 11057281) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 7-methoxy-2,2,5-trimethylnaphtho[3,2-g][1,3]benzodioxine-4,6,11-trione.
| Compound Name | 7-methoxy-2,2,5-trimethylnaphtho[3,2-g][1,3]benzodioxine-4,6,11-trione |
|---|---|
| PubChem CID | 11057281 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 7-methoxy-2,2,5-trimethylnaphtho[3,2-g][1,3]benzodioxine-4,6,11-trione |
| SMILES | COc1cccc2c1C(=O)c1c(cc3c(c1C)C(=O)OC(C)(C)O3)C2=O |
| InChI | InChI=1S/C20H16O6/c1-9-14-11(8-13-15(9)19(23)26-20(2,3)25-13)17(21)10-6-5-7-12(24-4)16(10)18(14)22/h5-8H,1-4H3 |
| InChIKey | ODGQDSIIRQJRDT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|