C15H12O5 — CID 14861205
2-(1-hydroxyethyl)-8-methoxybenzo[f][1]benzofuran-4,9-dione (PubChem CID 14861205) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-8-methoxybenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-(1-hydroxyethyl)-8-methoxybenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 14861205 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(1-hydroxyethyl)-8-methoxybenzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1cccc2c1C(=O)c1oc(C(C)O)cc1C2=O |
| InChI | InChI=1S/C15H12O5/c1-7(16)11-6-9-13(17)8-4-3-5-10(19-2)12(8)14(18)15(9)20-11/h3-7,16H,1-2H3 |
| InChIKey | FNTNBRDMWJABMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|